CAS 5057-12-5 appears in our catalog under these names: 4,6,7,8-TETRAHYDRO-1H,3H-QUINOLINE-2,5-DIONE, 98%, Carteolol HCl EP Impurity A, 4,6,7,8-Tetrahydro-2,5(1H,3H)-quinolinedione, 3,4,7,8–Tetrahydroquinoline–2,5(1H,6H)–dione, 3,4,7,8-Tetrahydroquinoline-2,5(1H,6H)-dione, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Chemat. Available pack sizes: 25g, 1g, 5g, on request, 50mg, 250mg, 100mg, 10g.
1,3,4,6,7,8-hexahydroquinoline-2,5-dione (CAS 5057-12-5) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1,3,4,6,7,8-hexahydroquinoline-2,5-dione. InChIKey: KNRFNTVMEIIKEB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| InChIKey | KNRFNTVMEIIKEB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CCC(=O)N2)C(=O)C1 |
Computed by PubChem (NCBI)