CAS 50585-92-7 appears in our catalog under these names: 1-Benzylpiperidine-3-carboxylic acid hydrochloride, 95%, 1-Benzylpiperidine-3-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
1-benzylpiperidine-3-carboxylic acid;hydrochloride (CAS 50585-92-7) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 1-benzylpiperidine-3-carboxylic acid;hydrochloride. InChIKey: GDQLYIBFDWPBDT-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 1-benzylpiperidine-3-carboxylic acid;hydrochloride |
| InChIKey | GDQLYIBFDWPBDT-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)