CAS 50604-12-1 is the registry number for Methyl 4-(2-hydroxypropan-2-yl)benzoate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-(2-hydroxypropan-2-yl)benzoate (CAS 50604-12-1) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: methyl 4-(2-hydroxypropan-2-yl)benzoate. InChIKey: INERTZMRNZLDIB-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | methyl 4-(2-hydroxypropan-2-yl)benzoate |
| InChIKey | INERTZMRNZLDIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(=O)OC)O |
Computed by PubChem (NCBI)