CAS 50632-89-8 appears in our catalog under these names: Glycyl-D-tryptophan, 97%, H–Gly–D–Trp–OH, H-Gly-D-Trp-OH 95%, H-Gly-D-Trp-OH, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 5g, 1g.
(2R)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoic acid (CAS 50632-89-8) is a chemical compound with the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. IUPAC name: (2R)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: AJHCSUXXECOXOY-LLVKDONJSA-N.
| Molecular formula | C13H15N3O3 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | (2R)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | AJHCSUXXECOXOY-LLVKDONJSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](C(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)