Products 50656-77-4
CAS 50656-77-4 appears in our catalog under these names: Niranthin, 95%, Niranthin, rac-Niranthin, Niranthin/ 99.8% (existing batch purity), Niranthin (Standard). Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, on request, 1mg, 5mg, 10mg, 25mg, 50mg, 0,25mg.
6-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-2-(methoxymethyl)butyl]-4-methoxy-1,3-benzodioxole (CAS 50656-77-4) is a chemical compound with the molecular formula C24H32O7 and a molecular weight of 432.5 g/mol. IUPAC name: 6-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-2-(methoxymethyl)butyl]-4-methoxy-1,3-benzodioxole. InChIKey: RCFGIEPQSDGMJJ-RTBURBONSA-N.
| Molecular formula | C24H32O7 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 6-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-2-(methoxymethyl)butyl]-4-methoxy-1,3-benzodioxole |
| InChIKey | RCFGIEPQSDGMJJ-RTBURBONSA-N |
| SMILES | COC[C@@H](CC1=CC(=C(C=C1)OC)OC)[C@H](CC2=CC3=C(C(=C2)OC)OCO3)COC |
Computed by PubChem (NCBI)