CAS 7432-28-2 appears in our catalog under these names: Schizandrol, >95% (HPLC), Schisandrin/ 99.55% (existing batch purity), Schizandrin, Schisandrin (Standard), Schisandrin, 99.97%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 250mg, 50mg, 20mg, 100mg, 5mg, 25mg, 2000mg.
(9S,10S)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-ol (CAS 7432-28-2) is a chemical compound with the molecular formula C24H32O7 and a molecular weight of 432.5 g/mol. IUPAC name: (9S,10S)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-ol. InChIKey: YEFOAORQXAOVJQ-RZFZLAGVSA-N.
| Molecular formula | C24H32O7 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (9S,10S)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-ol |
| InChIKey | YEFOAORQXAOVJQ-RZFZLAGVSA-N |
| SMILES | C[C@H]1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3C[C@]1(C)O)OC)OC)OC)OC)OC)OC |
Computed by PubChem (NCBI)