Products 50731-50-5

CAS 50731-50-5 is the registry number for 2-Amino-3-hydroxy-4-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-3-hydroxy-4-phenylbutanoic acid (CAS 50731-50-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-amino-3-hydroxy-4-phenylbutanoic acid. InChIKey: CMGJFSCKGIKDJV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC name2-amino-3-hydroxy-4-phenylbutanoic acid
InChIKeyCMGJFSCKGIKDJV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(C(=O)O)N)O

Computed by PubChem (NCBI)