CAS 50807-74-4 is the registry number for 2,2,3,3,3-Pentafluoropropyl-1,1,2,2-tetrafluoroethyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1,1,1,2,2-pentafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane (CAS 50807-74-4) is a chemical compound with the molecular formula C5H3F9O and a molecular weight of 250.06 g/mol. IUPAC name: 1,1,1,2,2-pentafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane. InChIKey: RPSFZSRVLPIAMN-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 1,1,1,2,2-pentafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane |
| InChIKey | RPSFZSRVLPIAMN-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(F)F)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)