CAS 355-28-2 appears in our catalog under these names: 1H,1H-Perfluoropentan-1-ol, 95%, 1H,1H–Nonafluoro–1–pentanol, 1H,1H-Nonafluoro-1-pentanol, >97.0%(GC), 1H,1H-Perfluoropentan-1-ol, 98%, 98%, 1H,1H-Perfluoropentan-1-ol, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol (CAS 355-28-2) is a chemical compound with the molecular formula C5H3F9O and a molecular weight of 250.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol. InChIKey: PJRIQFXPYMVWOU-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol |
| InChIKey | PJRIQFXPYMVWOU-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)