CAS 50889-30-0 is the registry number for 7–(Triphenylphosphonio)heptanoate hydrobromide. Offered by: GLPBio. Available pack sizes: 1g.
6-carboxyhexyl(triphenyl)phosphanium bromide (CAS 50889-30-0) is a chemical compound with the molecular formula C25H28BrO2P and a molecular weight of 471.4 g/mol. IUPAC name: 6-carboxyhexyl(triphenyl)phosphanium bromide. InChIKey: IASRMNRQZIRYHM-UHFFFAOYSA-N.
| Molecular formula | C25H28BrO2P |
|---|---|
| Molecular weight | 471.4 g/mol |
| IUPAC name | 6-carboxyhexyl(triphenyl)phosphanium bromide |
| InChIKey | IASRMNRQZIRYHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[P+](CCCCCCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)