CAS 54110-96-2 is the registry number for 4-Carboethoxybutyl triphenylphosphonium bromide. Offered by: Chemat. Available pack sizes: 25g.
(5-ethoxy-5-oxopentyl)-triphenylphosphanium bromide (CAS 54110-96-2) is a chemical compound with the molecular formula C25H28BrO2P and a molecular weight of 471.4 g/mol. IUPAC name: (5-ethoxy-5-oxopentyl)-triphenylphosphanium bromide. InChIKey: WIZBVXRRVWMYTB-UHFFFAOYSA-M.
| Molecular formula | C25H28BrO2P |
|---|---|
| Molecular weight | 471.4 g/mol |
| IUPAC name | (5-ethoxy-5-oxopentyl)-triphenylphosphanium bromide |
| InChIKey | WIZBVXRRVWMYTB-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)