CAS 5090-87-9 is the registry number for Mansonone E. Offered by: Chemat Brand, TargetMol. Available pack sizes: on request, 25mg, 50mg, 100mg.
4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8-tetraene-10,11-dione (CAS 5090-87-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8-tetraene-10,11-dione. InChIKey: SYWTYRLIJCHSLJ-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8-tetraene-10,11-dione |
| InChIKey | SYWTYRLIJCHSLJ-UHFFFAOYSA-N |
| SMILES | CC1COC2=C(C(=O)C(=O)C3=C(C=CC1=C32)C)C |
Computed by PubChem (NCBI)