CAS 51012-62-5 appears in our catalog under these names: 2-Bromo-1-[4-(propan-2-yl)phenyl]ethan-1-one, 95%, 2-Bromo-4’-isopropylacetophenone. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 500mg.
2-bromo-1-(4-propan-2-ylphenyl)ethanone (CAS 51012-62-5) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 2-bromo-1-(4-propan-2-ylphenyl)ethanone. InChIKey: ZSCDQVYYLJSTFU-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 2-bromo-1-(4-propan-2-ylphenyl)ethanone |
| InChIKey | ZSCDQVYYLJSTFU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)