CAS 51018-87-2 appears in our catalog under these names: (R)-4-Isobutyloxazolidine-2,5-dione, 97%, (R)-4-Isobutyloxazolidine-2,5-dione, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
(4R)-4-(2-methylpropyl)-1,3-oxazolidine-2,5-dione (CAS 51018-87-2) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: (4R)-4-(2-methylpropyl)-1,3-oxazolidine-2,5-dione. InChIKey: JHWZWIVZROVFEM-RXMQYKEDSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | (4R)-4-(2-methylpropyl)-1,3-oxazolidine-2,5-dione |
| InChIKey | JHWZWIVZROVFEM-RXMQYKEDSA-N |
| SMILES | CC(C)C[C@@H]1C(=O)OC(=O)N1 |
Computed by PubChem (NCBI)