CAS 51207-98-8 is the registry number for N-Butyl-4-nitrobenzamide, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
N-butyl-4-nitrobenzamide (CAS 51207-98-8) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: N-butyl-4-nitrobenzamide. InChIKey: ZPYLRHGQFFDNOH-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N-butyl-4-nitrobenzamide |
| InChIKey | ZPYLRHGQFFDNOH-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)