CAS 5124-25-4 is the registry number for Disperse Yellow 42. Offered by: MedChemExpress. Available pack sizes: 1 g.
4-anilino-3-nitro-N-phenylbenzenesulfonamide (CAS 5124-25-4) is a chemical compound with the molecular formula C18H15N3O4S and a molecular weight of 369.4 g/mol. IUPAC name: 4-anilino-3-nitro-N-phenylbenzenesulfonamide. InChIKey: BBFRYSKTTHYWQZ-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O4S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-anilino-3-nitro-N-phenylbenzenesulfonamide |
| InChIKey | BBFRYSKTTHYWQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)