CAS 708992-34-1 is the registry number for SIRT5 inhibitor 4. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 1 mg, 50 mg, 10 mg.
4-[[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid (CAS 708992-34-1) is a chemical compound with the molecular formula C18H15N3O4S and a molecular weight of 369.4 g/mol. IUPAC name: 4-[[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid. InChIKey: LIAJYAVQSHCRSC-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O4S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-[[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]amino]-2-hydroxybenzoic acid |
| InChIKey | LIAJYAVQSHCRSC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C2=CSC(=N2)NC3=CC(=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)