Products 514798-03-9
CAS 514798-03-9 appears in our catalog under these names: 3-Chloro-5-fluoroisonicotinic acid, 96%, 3-Chloro-5-fluoroisonicotinic acid, 3-Chloro-5-fluoroisonicotinic acid 98%, 3-Chloro-5-fluoroisonicotinic acid, 97%, 97%, 3-Chloro-5-fluoroisonicotinic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g, 100mg, 500mg, 25g.
3-chloro-5-fluoropyridine-4-carboxylic acid (CAS 514798-03-9) is a chemical compound with the molecular formula C6H3ClFNO2 and a molecular weight of 175.54 g/mol. IUPAC name: 3-chloro-5-fluoropyridine-4-carboxylic acid. InChIKey: APKYTXKVPCYUOG-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO2 |
|---|---|
| Molecular weight | 175.54 g/mol |
| IUPAC name | 3-chloro-5-fluoropyridine-4-carboxylic acid |
| InChIKey | APKYTXKVPCYUOG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(=O)O)F |
Computed by PubChem (NCBI)