CAS 860296-20-4 appears in our catalog under these names: 4-Chloro-5-fluoronicotinic acid, 95%, 4-Chloro-5-fluoropyridine-3-carboxylic acid, 4-CHLORO-5-FLUORONICOTINIC ACID, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 0,5g, 100mg.
4-chloro-5-fluoropyridine-3-carboxylic acid (CAS 860296-20-4) is a chemical compound with the molecular formula C6H3ClFNO2 and a molecular weight of 175.54 g/mol. IUPAC name: 4-chloro-5-fluoropyridine-3-carboxylic acid. InChIKey: SDRWXOCHMBWAAW-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO2 |
|---|---|
| Molecular weight | 175.54 g/mol |
| IUPAC name | 4-chloro-5-fluoropyridine-3-carboxylic acid |
| InChIKey | SDRWXOCHMBWAAW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)F)Cl)C(=O)O |
Computed by PubChem (NCBI)