CAS 51486-16-9 is the registry number for 3-Allyl-5,6-dimethyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
5,6-dimethyl-3-prop-2-enyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 51486-16-9) is a chemical compound with the molecular formula C11H12N2OS2 and a molecular weight of 252.4 g/mol. IUPAC name: 5,6-dimethyl-3-prop-2-enyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: UIDZXXIBHNLIGD-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS2 |
|---|---|
| Molecular weight | 252.4 g/mol |
| IUPAC name | 5,6-dimethyl-3-prop-2-enyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | UIDZXXIBHNLIGD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C(=S)N2)CC=C)C |
Computed by PubChem (NCBI)