CAS 878222-29-8 is the registry number for N-{(5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl)methyl}acetamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]acetamide (CAS 878222-29-8) is a chemical compound with the molecular formula C11H12N2OS2 and a molecular weight of 252.4 g/mol. IUPAC name: N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]acetamide. InChIKey: QFTRDDHQBIPHCI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS2 |
|---|---|
| Molecular weight | 252.4 g/mol |
| IUPAC name | N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]acetamide |
| InChIKey | QFTRDDHQBIPHCI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(S2)CNC(=O)C |
Computed by PubChem (NCBI)