Products 515143-80-3
CAS 515143-80-3 is the registry number for 3-((3-Aminophenyl)methyl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-[(3-aminophenyl)methyl]imidazolidine-2,4-dione (CAS 515143-80-3) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 3-[(3-aminophenyl)methyl]imidazolidine-2,4-dione. InChIKey: ODNCNVHRERQZOX-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 3-[(3-aminophenyl)methyl]imidazolidine-2,4-dione |
| InChIKey | ODNCNVHRERQZOX-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)