CAS 515176-14-4 is the registry number for N-((1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl)-2,2,2-trifluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-2,2,2-trifluoroacetamide (CAS 515176-14-4) is a chemical compound with the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. IUPAC name: N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-2,2,2-trifluoroacetamide. InChIKey: BFXCPYONNIQIJS-UHFFFAOYSA-N.
| Molecular formula | C9H12F3N3O |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-2,2,2-trifluoroacetamide |
| InChIKey | BFXCPYONNIQIJS-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C)CNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)