Products 55545-81-8
CAS 55545-81-8 is the registry number for 2-(Diethylamino)-6-(trifluoromethyl)pyrimidin-4(3H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(diethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one (CAS 55545-81-8) is a chemical compound with the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. IUPAC name: 2-(diethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one. InChIKey: KXEVHRJJOAFGFB-UHFFFAOYSA-N.
| Molecular formula | C9H12F3N3O |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | 2-(diethylamino)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| InChIKey | KXEVHRJJOAFGFB-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC(=CC(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)