CAS 5158-64-5 appears in our catalog under these names: (2S,3R,4R,5S,6S)–2–bromo–6–methyltetrahydro–2H–pyran–3,4,5–triyl triacetate, 2,3,4-Tri-O-acetyl-α-L-rhamnopyranosyl bromide. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate (CAS 5158-64-5) is a chemical compound with the molecular formula C12H17BrO7 and a molecular weight of 353.16 g/mol. IUPAC name: [(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate. InChIKey: XUZQAPSYNYIKSR-QLOSAFNOSA-N.
| Molecular formula | C12H17BrO7 |
|---|---|
| Molecular weight | 353.16 g/mol |
| IUPAC name | [(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate |
| InChIKey | XUZQAPSYNYIKSR-QLOSAFNOSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)Br)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)