CAS 516445-83-3 is the registry number for N-Tricyclo(3.3.1.13,7)dec-1-yl-1H-Indazole-3-carboxamide. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
N-(1-adamantyl)-1H-indazole-3-carboxamide (CAS 516445-83-3) is a chemical compound with the molecular formula C18H21N3O and a molecular weight of 295.4 g/mol. IUPAC name: N-(1-adamantyl)-1H-indazole-3-carboxamide. InChIKey: CMBJQJBQELVJHE-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | N-(1-adamantyl)-1H-indazole-3-carboxamide |
| InChIKey | CMBJQJBQELVJHE-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)C4=NNC5=CC=CC=C54 |
Computed by PubChem (NCBI)