CAS 881449-98-5 is the registry number for 1,3-Dimethyl-5-(((1-phenylethyl)amino)methyl)-1,3-dihydro-2H-benzo[d]imidazol-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-5-[(1-phenylethylamino)methyl]benzimidazol-2-one (CAS 881449-98-5) is a chemical compound with the molecular formula C18H21N3O and a molecular weight of 295.4 g/mol. IUPAC name: 1,3-dimethyl-5-[(1-phenylethylamino)methyl]benzimidazol-2-one. InChIKey: JJJSFNAYCUSJCN-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 1,3-dimethyl-5-[(1-phenylethylamino)methyl]benzimidazol-2-one |
| InChIKey | JJJSFNAYCUSJCN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NCC2=CC3=C(C=C2)N(C(=O)N3C)C |
Computed by PubChem (NCBI)