Products 51666-26-3
CAS 51666-26-3 is the registry number for Erythrartine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
(2R,9R,13bS)-2,11,12-trimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-9-ol (CAS 51666-26-3) is a chemical compound with the molecular formula C19H23NO4 and a molecular weight of 329.4 g/mol. IUPAC name: (2R,9R,13bS)-2,11,12-trimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-9-ol. InChIKey: QWWCVLZNFFVFTR-AXHNFQJDSA-N.
| Molecular formula | C19H23NO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (2R,9R,13bS)-2,11,12-trimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-9-ol |
| InChIKey | QWWCVLZNFFVFTR-AXHNFQJDSA-N |
| SMILES | CO[C@@H]1C[C@@]23C(=CCN2C[C@@H](C4=CC(=C(C=C34)OC)OC)O)C=C1 |
Computed by PubChem (NCBI)