CAS 51721-21-2 appears in our catalog under these names: ethyl 4–tert–butyl–1H–iMidazole –5–carboxylate, Ethyl 5-(tert-butyl)-1H-imidazole-4-carboxylate, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg.
Ethyl 5-tert-butyl-1H-imidazole-4-carboxylate (CAS 51721-21-2) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: ethyl 5-tert-butyl-1H-imidazole-4-carboxylate. InChIKey: ZWLWFCKNFSOIEA-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | ethyl 5-tert-butyl-1H-imidazole-4-carboxylate |
| InChIKey | ZWLWFCKNFSOIEA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC=N1)C(C)(C)C |
Computed by PubChem (NCBI)