Products 51762-52-8

CAS 51762-52-8 is the registry number for 9-Oxo-9h-thioxanthene-3-carboxylic acid 10,10-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

9,10,10-trioxothioxanthene-3-carboxylic acid (CAS 51762-52-8) is a chemical compound with the molecular formula C14H8O5S and a molecular weight of 288.28 g/mol. IUPAC name: 9,10,10-trioxothioxanthene-3-carboxylic acid. InChIKey: KTMTUGYSHWKLNN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8O5S
Molecular weight288.28 g/mol
IUPAC name9,10,10-trioxothioxanthene-3-carboxylic acid
InChIKeyKTMTUGYSHWKLNN-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)C3=C(S2(=O)=O)C=C(C=C3)C(=O)O

Computed by PubChem (NCBI)