CAS 51762-52-8 is the registry number for 9-Oxo-9h-thioxanthene-3-carboxylic acid 10,10-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9,10,10-trioxothioxanthene-3-carboxylic acid (CAS 51762-52-8) is a chemical compound with the molecular formula C14H8O5S and a molecular weight of 288.28 g/mol. IUPAC name: 9,10,10-trioxothioxanthene-3-carboxylic acid. InChIKey: KTMTUGYSHWKLNN-UHFFFAOYSA-N.
| Molecular formula | C14H8O5S |
|---|---|
| Molecular weight | 288.28 g/mol |
| IUPAC name | 9,10,10-trioxothioxanthene-3-carboxylic acid |
| InChIKey | KTMTUGYSHWKLNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2(=O)=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)