CAS 84-48-0 is the registry number for 9,10-Dihydro-9,10-dioxo-2-anthracenesulfonic acid. Offered by: Chemat. Available pack sizes: 100mg.
9,10-dioxoanthracene-2-sulfonic acid (CAS 84-48-0) is a chemical compound with the molecular formula C14H8O5S and a molecular weight of 288.28 g/mol. IUPAC name: 9,10-dioxoanthracene-2-sulfonic acid. InChIKey: MMNWSHJJPDXKCH-UHFFFAOYSA-N.
| Molecular formula | C14H8O5S |
|---|---|
| Molecular weight | 288.28 g/mol |
| IUPAC name | 9,10-dioxoanthracene-2-sulfonic acid |
| InChIKey | MMNWSHJJPDXKCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)O |
Computed by PubChem (NCBI)