CAS 5184-64-5 appears in our catalog under these names: ESI-05, ESI-05/ 98%, ESI-05 98%, 1,3,5-Trimethyl-2-tosylbenzene, 98%, 98%, ESI-05, 99.94%. Offered by: TRC, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 750mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
1,3,5-trimethyl-2-(4-methylphenyl)sulfonylbenzene (CAS 5184-64-5) is a chemical compound with the molecular formula C16H18O2S and a molecular weight of 274.4 g/mol. IUPAC name: 1,3,5-trimethyl-2-(4-methylphenyl)sulfonylbenzene. InChIKey: CGPHOZWFSFNOEQ-UHFFFAOYSA-N.
| Molecular formula | C16H18O2S |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-(4-methylphenyl)sulfonylbenzene |
| InChIKey | CGPHOZWFSFNOEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)