CAS 861432-72-6 appears in our catalog under these names: 5-(4-(tert-Butyl)phenyl)-4-methylthiophene-2-carboxylic acid, 95+%, 5-(4-tert-Butylphenyl)-4-methylthiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
5-(4-tert-butylphenyl)-4-methylthiophene-2-carboxylic acid (CAS 861432-72-6) is a chemical compound with the molecular formula C16H18O2S and a molecular weight of 274.4 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-4-methylthiophene-2-carboxylic acid. InChIKey: PPOWKZVFZODKAT-UHFFFAOYSA-N.
| Molecular formula | C16H18O2S |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-4-methylthiophene-2-carboxylic acid |
| InChIKey | PPOWKZVFZODKAT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)