CAS 5184-70-3 is the registry number for 1-Bromo-4-tosylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-bromophenyl)sulfonyl-4-methylbenzene (CAS 5184-70-3) is a chemical compound with the molecular formula C13H11BrO2S and a molecular weight of 311.20 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-4-methylbenzene. InChIKey: HFORIYQHAWLZJQ-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2S |
|---|---|
| Molecular weight | 311.20 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-4-methylbenzene |
| InChIKey | HFORIYQHAWLZJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)