CAS 92022-50-9 appears in our catalog under these names: 2-Bromobenzyl phenyl sulfone, 95%, 1-Bromo-2-((phenylsulfonyl)methyl)benzene, 98%, 2–Bromobenzyl Phenyl Sulfone, 2-Bromobenzyl Phenyl Sulfone, >98.0%(GC), 2-Bromobenzyl Phenyl Sulfone, 98.0%, 98.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg, 5g.
1-(benzenesulfonylmethyl)-2-bromobenzene (CAS 92022-50-9) is a chemical compound with the molecular formula C13H11BrO2S and a molecular weight of 311.20 g/mol. IUPAC name: 1-(benzenesulfonylmethyl)-2-bromobenzene. InChIKey: CQNGEPLMWCLSBR-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2S |
|---|---|
| Molecular weight | 311.20 g/mol |
| IUPAC name | 1-(benzenesulfonylmethyl)-2-bromobenzene |
| InChIKey | CQNGEPLMWCLSBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC2=CC=CC=C2Br |
Computed by PubChem (NCBI)