CAS 51877-74-8 appears in our catalog under these names: (+)–trans–Permethrin, (+)-trans-Permethrin, 99.33%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 5 mg, 25 mg, 10 mg.
Cis-(3-phenoxyphenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 51877-74-8) is a chemical compound with the molecular formula C21H20Cl2O3 and a molecular weight of 391.3 g/mol. IUPAC name: cis-(3-phenoxyphenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: RLLPVAHGXHCWKJ-MJGOQNOKSA-N.
| Molecular formula | C21H20Cl2O3 |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | cis-(3-phenoxyphenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | RLLPVAHGXHCWKJ-MJGOQNOKSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)