CAS 51891-79-3 appears in our catalog under these names: 5-(4-Nitrophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(4-Nitrophenyl)-1,3,4-oxadiazol-2-amine, 98%, 98%, 5-(4-Nitrophenyl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g.
5-(4-nitrophenyl)-1,3,4-oxadiazol-2-amine (CAS 51891-79-3) is a chemical compound with the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. IUPAC name: 5-(4-nitrophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: PUEUDKAZSHKSOZ-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O3 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | PUEUDKAZSHKSOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)