CAS 7659-02-1 appears in our catalog under these names: 5-(3-Nitrophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3-nitrophenyl)-1,3,4-oxadiazol-2-amine, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g, 25g, 50g, 100g.
5-(3-nitrophenyl)-1,3,4-oxadiazol-2-amine (CAS 7659-02-1) is a chemical compound with the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. IUPAC name: 5-(3-nitrophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: ZCDYCESVPSXZFM-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O3 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | ZCDYCESVPSXZFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NN=C(O2)N |
Computed by PubChem (NCBI)