CAS 519-12-0 is the registry number for Setoclavine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6aR,9S)-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol (CAS 519-12-0) is a chemical compound with the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. IUPAC name: (6aR,9S)-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol. InChIKey: BGVUWLLRNRBDAY-ZBFHGGJFSA-N.
| Molecular formula | C16H18N2O |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | (6aR,9S)-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol |
| InChIKey | BGVUWLLRNRBDAY-ZBFHGGJFSA-N |
| SMILES | C[C@]1(CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C)O |
Computed by PubChem (NCBI)