CAS 519-13-1 is the registry number for Penniclavine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6aR,9S)-9-(hydroxymethyl)-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol (CAS 519-13-1) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: (6aR,9S)-9-(hydroxymethyl)-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol. InChIKey: KCHBNRCSCHMJFD-ZBFHGGJFSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | (6aR,9S)-9-(hydroxymethyl)-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol |
| InChIKey | KCHBNRCSCHMJFD-ZBFHGGJFSA-N |
| SMILES | CN1C[C@@](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)(CO)O |
Computed by PubChem (NCBI)