CAS 51924-81-3 is the registry number for 3-anilino-1,5,6,7-tetrahydro-6,6-dimethyl-4H-indazol-4-one hydrazone. Offered by: Biosynth. Available pack sizes: 250mg.
4-hydrazinylidene-6,6-dimethyl-N-phenyl-5,7-dihydro-1H-indazol-3-amine (CAS 51924-81-3) is a chemical compound with the molecular formula C15H19N5 and a molecular weight of 269.34 g/mol. IUPAC name: 4-hydrazinylidene-6,6-dimethyl-N-phenyl-5,7-dihydro-1H-indazol-3-amine. InChIKey: TWRIAIBOIPGYSV-UHFFFAOYSA-N.
| Molecular formula | C15H19N5 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 4-hydrazinylidene-6,6-dimethyl-N-phenyl-5,7-dihydro-1H-indazol-3-amine |
| InChIKey | TWRIAIBOIPGYSV-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=NN)C1)C(=NN2)NC3=CC=CC=C3)C |
Computed by PubChem (NCBI)