CAS 52041-82-4 is the registry number for (5-Bromo-2-(p-tolyl)thiazol-4-yl)methanol 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[5-bromo-2-(4-methylphenyl)-1,3-thiazol-4-yl]methanol (CAS 52041-82-4) is a chemical compound with the molecular formula C11H10BrNOS and a molecular weight of 284.17 g/mol. IUPAC name: [5-bromo-2-(4-methylphenyl)-1,3-thiazol-4-yl]methanol. InChIKey: ACFQZGWPSUKZAY-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNOS |
|---|---|
| Molecular weight | 284.17 g/mol |
| IUPAC name | [5-bromo-2-(4-methylphenyl)-1,3-thiazol-4-yl]methanol |
| InChIKey | ACFQZGWPSUKZAY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=C(S2)Br)CO |
Computed by PubChem (NCBI)