CAS 1955523-30-4 appears in our catalog under these names: 1-(2-Phenyl-1,3-thiazol-4-yl)ethan-1-one hydrobromide, 95%, 1-(2-Phenyl-1,3-thiazol-4-yl)ethan-1-one hydrobromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
1-(2-phenyl-1,3-thiazol-4-yl)ethanone;hydrobromide (CAS 1955523-30-4) is a chemical compound with the molecular formula C11H10BrNOS and a molecular weight of 284.17 g/mol. IUPAC name: 1-(2-phenyl-1,3-thiazol-4-yl)ethanone;hydrobromide. InChIKey: CXRHCKSTPIJUNQ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNOS |
|---|---|
| Molecular weight | 284.17 g/mol |
| IUPAC name | 1-(2-phenyl-1,3-thiazol-4-yl)ethanone;hydrobromide |
| InChIKey | CXRHCKSTPIJUNQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CSC(=N1)C2=CC=CC=C2.Br |
Computed by PubChem (NCBI)