CAS 1250820-48-4 appears in our catalog under these names: 1-(2-(4-Bromophenyl)-1,3-thiazol-5-yl)ethan-1-ol, 95%, 1-(2-(4-Bromophenyl)-1,3-thiazol-5-yl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[2-(4-bromophenyl)-1,3-thiazol-5-yl]ethanol (CAS 1250820-48-4) is a chemical compound with the molecular formula C11H10BrNOS and a molecular weight of 284.17 g/mol. IUPAC name: 1-[2-(4-bromophenyl)-1,3-thiazol-5-yl]ethanol. InChIKey: AMWYWMJSHXIUJH-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNOS |
|---|---|
| Molecular weight | 284.17 g/mol |
| IUPAC name | 1-[2-(4-bromophenyl)-1,3-thiazol-5-yl]ethanol |
| InChIKey | AMWYWMJSHXIUJH-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(S1)C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)