CAS 5207-52-3 appears in our catalog under these names: 5,6-Diphenylfuro[2,3-d]pyrimidin-4-amine, 95%, 5,6-Diphenylfuro(2,3-d)pyrimidin-4-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5,6-diphenylfuro[2,3-d]pyrimidin-4-amine (CAS 5207-52-3) is a chemical compound with the molecular formula C18H13N3O and a molecular weight of 287.3 g/mol. IUPAC name: 5,6-diphenylfuro[2,3-d]pyrimidin-4-amine. InChIKey: APAOWMPUWGJZFS-UHFFFAOYSA-N.
| Molecular formula | C18H13N3O |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 5,6-diphenylfuro[2,3-d]pyrimidin-4-amine |
| InChIKey | APAOWMPUWGJZFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC3=NC=NC(=C23)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)