Products 79492-49-2
CAS 79492-49-2 is the registry number for Pim-1 kinase inhibitor 13. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-6-(4-hydroxyphenyl)-4-phenylpyridine-3-carbonitrile (CAS 79492-49-2) is a chemical compound with the molecular formula C18H13N3O and a molecular weight of 287.3 g/mol. IUPAC name: 2-amino-6-(4-hydroxyphenyl)-4-phenylpyridine-3-carbonitrile. InChIKey: VVFRJCXNTHXSOG-UHFFFAOYSA-N.
| Molecular formula | C18H13N3O |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 2-amino-6-(4-hydroxyphenyl)-4-phenylpyridine-3-carbonitrile |
| InChIKey | VVFRJCXNTHXSOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=C2C#N)N)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)