Products 521-67-5
CAS 521-67-5 appears in our catalog under these names: Cinnamoylcocaine, >95% (HPLC), Cinnamoylcocaine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
Methyl (1R,2R,3S,5S)-8-methyl-3-[(E)-3-phenylprop-2-enoyl]oxy-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 521-67-5) is a chemical compound with the molecular formula C19H23NO4 and a molecular weight of 329.4 g/mol. IUPAC name: methyl (1R,2R,3S,5S)-8-methyl-3-[(E)-3-phenylprop-2-enoyl]oxy-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: MQIXMJWNEKUAOZ-UYCDZTDFSA-N.
| Molecular formula | C19H23NO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | methyl (1R,2R,3S,5S)-8-methyl-3-[(E)-3-phenylprop-2-enoyl]oxy-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | MQIXMJWNEKUAOZ-UYCDZTDFSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)/C=C/C3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)