Products 52123-79-2
CAS 52123-79-2 appears in our catalog under these names: Esketamine hydrochloride Impurity 5, (1-Bromocyclopentyl)(3-chlorophenyl)methanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
(1-bromocyclopentyl)-(3-chlorophenyl)methanone (CAS 52123-79-2) is a chemical compound with the molecular formula C12H12BrClO and a molecular weight of 287.58 g/mol. IUPAC name: (1-bromocyclopentyl)-(3-chlorophenyl)methanone. InChIKey: MHSREKDYSLFGHR-UHFFFAOYSA-N.
| Molecular formula | C12H12BrClO |
|---|---|
| Molecular weight | 287.58 g/mol |
| IUPAC name | (1-bromocyclopentyl)-(3-chlorophenyl)methanone |
| InChIKey | MHSREKDYSLFGHR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C(=O)C2=CC(=CC=C2)Cl)Br |
Computed by PubChem (NCBI)