CAS 6740-86-9 appears in our catalog under these names: (1-Bromocyclopentyl)(2-chlorophenyl)methanone, 95%, Ketamine Impurity 6, 1-Bromocyclopentyl 2-Chlorophenyl Ketone. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 1g, 5g, 10g, on request, 100mg, 500mg.
(1-bromocyclopentyl)-(2-chlorophenyl)methanone (CAS 6740-86-9) is a chemical compound with the molecular formula C12H12BrClO and a molecular weight of 287.58 g/mol. IUPAC name: (1-bromocyclopentyl)-(2-chlorophenyl)methanone. InChIKey: DDVNLGGCSRULIL-UHFFFAOYSA-N.
| Molecular formula | C12H12BrClO |
|---|---|
| Molecular weight | 287.58 g/mol |
| IUPAC name | (1-bromocyclopentyl)-(2-chlorophenyl)methanone |
| InChIKey | DDVNLGGCSRULIL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C(=O)C2=CC=CC=C2Cl)Br |
Computed by PubChem (NCBI)