Products 521297-42-7
CAS 521297-42-7 is the registry number for Phosphodiesterase-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(4-fluorophenyl)methyl]-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one (CAS 521297-42-7) is a chemical compound with the molecular formula C15H15FN4O and a molecular weight of 286.30 g/mol. IUPAC name: 5-[(4-fluorophenyl)methyl]-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one. InChIKey: KNEISJHXOXOHGE-UHFFFAOYSA-N.
| Molecular formula | C15H15FN4O |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methyl]-3-propan-2-yl-2,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| InChIKey | KNEISJHXOXOHGE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=NN1)C(=O)NC(=N2)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)